C13H15Cl2FN2O — CID 119572424
N-(1-amino-2-cyclopropylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide (PubChem CID 119572424) has the molecular formula C13H15Cl2FN2O and a molecular weight of 305.18 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 119572424 |
| Molecular Formula | C13H15Cl2FN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide |
| SMILES | CC(CN)(NC(=O)c1cc(F)c(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C13H15Cl2FN2O/c1-13(6-17,7-2-3-7)18-12(19)8-4-11(16)10(15)5-9(8)14/h4-5,7H,2-3,6,17H2,1H3,(H,18,19) |
| InChIKey | YPQGPDMRFPJTLO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|