C15H9Cl2FO2 — CID 60928883
1-(2,4-dichloro-5-fluorophenyl)-3-phenylpropane-1,3-dione (PubChem CID 60928883) has the molecular formula C15H9Cl2FO2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 60928883 |
| Molecular Formula | C15H9Cl2FO2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-3-phenylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cc(F)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2FO2/c16-11-7-12(17)13(18)6-10(11)15(20)8-14(19)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | YPKIXPPZEKRTTH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|