C13H14Cl2FNO3 — CID 103926607
(2R)-2-[(2,4-dichloro-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 103926607) has the molecular formula C13H14Cl2FNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichloro-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dichloro-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103926607 |
| Molecular Formula | C13H14Cl2FNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | (2R)-2-[(2,4-dichloro-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14Cl2FNO3/c1-13(2,3)10(12(19)20)17-11(18)6-4-9(16)8(15)5-7(6)14/h4-5,10H,1-3H3,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | NDTGAJFXSJBMLK-JTQLQIEISA-N |
| XLogP | 3.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|