C13H15Cl2NO3 — CID 61145041
(2S)-2-[(2,3-dichlorobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 61145041) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is (2S)-2-[(2,3-dichlorobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(2,3-dichlorobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61145041 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (2S)-2-[(2,3-dichlorobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1cccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C13H15Cl2NO3/c1-13(2,3)10(12(18)19)16-11(17)7-5-4-6-8(14)9(7)15/h4-6,10H,1-3H3,(H,16,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | LIFDBAZZRZXASV-SNVBAGLBSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |