C11H13Cl2NO — CID 60643074
N-tert-butyl-2,3-dichlorobenzamide (PubChem CID 60643074) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is N-tert-butyl-2,3-dichlorobenzamide.
| Compound Name | N-tert-butyl-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 60643074 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-tert-butyl-2,3-dichlorobenzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-11(2,3)14-10(15)7-5-4-6-8(12)9(7)13/h4-6H,1-3H3,(H,14,15) |
| InChIKey | CJDRROQVOXQEQA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |