C12H13Cl2NO3S — CID 16773416
2-[(2,4-dichlorobenzoyl)amino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 16773416) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 16773416 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO3S/c1-12(2,19)9(11(17)18)15-10(16)7-4-3-6(13)5-8(7)14/h3-5,9,19H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BNSLFBBDNPAHEB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|