C9H4ClF5O — CID 107475730
1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-one (PubChem CID 107475730) has the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 107475730 |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C9H4ClF5O/c10-5-2-7(12)6(11)1-4(5)8(16)3-9(13,14)15/h1-2H,3H2 |
| InChIKey | LVWAJMDUXKRQOY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|