C12H11ClF2O3 — CID 54380038
propyl 3-(2-chloro-4,5-difluorophenyl)-3-oxopropanoate (PubChem CID 54380038) has the molecular formula C12H11ClF2O3 and a molecular weight of 276.67 g/mol. Its IUPAC name is propyl 3-(2-chloro-4,5-difluorophenyl)-3-oxopropanoate.
| Compound Name | propyl 3-(2-chloro-4,5-difluorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 54380038 |
| Molecular Formula | C12H11ClF2O3 |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | propyl 3-(2-chloro-4,5-difluorophenyl)-3-oxopropanoate |
| SMILES | CCCOC(=O)CC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H11ClF2O3/c1-2-3-18-12(17)6-11(16)7-4-9(14)10(15)5-8(7)13/h4-5H,2-3,6H2,1H3 |
| InChIKey | UZGJPBBZFVJDBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|