C14H13ClF2O5 — CID 57090902
1-O-(2-chloro-4,5-difluorobenzoyl) 3-O-ethyl 2-ethylpropanedioate (PubChem CID 57090902) has the molecular formula C14H13ClF2O5 and a molecular weight of 334.70 g/mol. Its IUPAC name is 1-O-(2-chloro-4,5-difluorobenzoyl) 3-O-ethyl 2-ethylpropanedioate.
| Compound Name | 1-O-(2-chloro-4,5-difluorobenzoyl) 3-O-ethyl 2-ethylpropanedioate |
|---|---|
| PubChem CID | 57090902 |
| Molecular Formula | C14H13ClF2O5 |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-O-(2-chloro-4,5-difluorobenzoyl) 3-O-ethyl 2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)C(=O)OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H13ClF2O5/c1-3-7(12(18)21-4-2)13(19)22-14(20)8-5-10(16)11(17)6-9(8)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | WQGJTJWUDLELSD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|