C16H23Cl2NO3 — CID 123638035
tert-butyl N-[4-(3,4-dichlorophenyl)-1-methoxybutan-2-yl]carbamate (PubChem CID 123638035) has the molecular formula C16H23Cl2NO3 and a molecular weight of 348.27 g/mol. Its IUPAC name is tert-butyl N-[4-(3,4-dichlorophenyl)-1-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(3,4-dichlorophenyl)-1-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123638035 |
| Molecular Formula | C16H23Cl2NO3 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | tert-butyl N-[4-(3,4-dichlorophenyl)-1-methoxybutan-2-yl]carbamate |
| SMILES | COCC(CCc1ccc(Cl)c(Cl)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23Cl2NO3/c1-16(2,3)22-15(20)19-12(10-21-4)7-5-11-6-8-13(17)14(18)9-11/h6,8-9,12H,5,7,10H2,1-4H3,(H,19,20) |
| InChIKey | MIPHNLULYMUGEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |