C15H19BrN2O4 — CID 89494811
tert-butyl N-[2-[[2-(2-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 89494811) has the molecular formula C15H19BrN2O4 and a molecular weight of 371.23 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 89494811 |
| Molecular Formula | C15H19BrN2O4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | tert-butyl N-[2-[[2-(2-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H19BrN2O4/c1-15(2,3)22-14(21)18-9-13(20)17-8-12(19)10-6-4-5-7-11(10)16/h4-7H,8-9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | XQNHBOPDXCNHTO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |