C14H17F3N2O3 — CID 108574426
butyl N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]carbamate (PubChem CID 108574426) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is butyl N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]carbamate.
| Compound Name | butyl N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108574426 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | butyl N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]carbamate |
| SMILES | CCCCOC(=O)NCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O3/c1-2-3-8-22-14(21)19-7-6-18-13(20)9-4-5-10(15)12(17)11(9)16/h4-5H,2-3,6-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | YJSUJORVXNPNLL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|