C14H18F3N3O2 — CID 108574424
N-[2-(diethylcarbamoylamino)ethyl]-2,3,4-trifluorobenzamide (PubChem CID 108574424) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[2-(diethylcarbamoylamino)ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(diethylcarbamoylamino)ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108574424 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-(diethylcarbamoylamino)ethyl]-2,3,4-trifluorobenzamide |
| SMILES | CCN(CC)C(=O)NCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H18F3N3O2/c1-3-20(4-2)14(22)19-8-7-18-13(21)9-5-6-10(15)12(17)11(9)16/h5-6H,3-4,7-8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | VHKXQPKMZDGTOK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|