C25H41BrN2O7S — CID 118276656
2-[(1R)-2-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3,3-dimethylbutanoic acid (PubChem CID 118276656) has the molecular formula C25H41BrN2O7S and a molecular weight of 593.58 g/mol. Its IUPAC name is 2-[(1R)-2-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(1R)-2-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 118276656 |
| Molecular Formula | C25H41BrN2O7S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 2-[(1R)-2-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3,3-dimethylbutanoic acid |
| SMILES | Cc1ccc(N(CCBr)CCOS(C)(=O)=O)cc1C[C@@H](NC(=O)OC(C)(C)C)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C25H41BrN2O7S/c1-17-9-10-19(28(12-11-26)13-14-34-36(8,32)33)15-18(17)16-20(21(22(29)30)24(2,3)4)27-23(31)35-25(5,6)7/h9-10,15,20-21H,11-14,16H2,1-8H3,(H,27,31)(H,29,30)/t20-,21?/m1/s1 |
| InChIKey | VDGUBGUUWWUWDR-VQCQRNETSA-N |
| XLogP | 4.36 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|