C16H25BrN2O5S — CID 118276543
(3R)-3-amino-4-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid (PubChem CID 118276543) has the molecular formula C16H25BrN2O5S and a molecular weight of 437.36 g/mol. Its IUPAC name is (3R)-3-amino-4-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid.
| Compound Name | (3R)-3-amino-4-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid |
|---|---|
| PubChem CID | 118276543 |
| Molecular Formula | C16H25BrN2O5S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (3R)-3-amino-4-[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid |
| SMILES | Cc1ccc(N(CCBr)CCOS(C)(=O)=O)cc1C[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C16H25BrN2O5S/c1-12-3-4-15(10-13(12)9-14(18)11-16(20)21)19(6-5-17)7-8-24-25(2,22)23/h3-4,10,14H,5-9,11,18H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | VWJHCDGBHIVRNE-CQSZACIVSA-N |
| XLogP | 1.52 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|