C16H22Cl2N2O4 — CID 126510912
(3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methoxycarbonylphenyl]butanoic acid (PubChem CID 126510912) has the molecular formula C16H22Cl2N2O4 and a molecular weight of 377.27 g/mol. Its IUPAC name is (3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methoxycarbonylphenyl]butanoic acid.
| Compound Name | (3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methoxycarbonylphenyl]butanoic acid |
|---|---|
| PubChem CID | 126510912 |
| Molecular Formula | C16H22Cl2N2O4 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (3S)-3-amino-4-[5-[bis(2-chloroethyl)amino]-2-methoxycarbonylphenyl]butanoic acid |
| SMILES | COC(=O)c1ccc(N(CCCl)CCCl)cc1C[C@H](N)CC(=O)O |
| InChI | InChI=1S/C16H22Cl2N2O4/c1-24-16(23)14-3-2-13(20(6-4-17)7-5-18)9-11(14)8-12(19)10-15(21)22/h2-3,9,12H,4-8,10,19H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | DQFBLZLYELSCDO-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|