C14H20Cl2N2O3 — CID 126511033
(3R)-3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid (PubChem CID 126511033) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is (3R)-3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid.
| Compound Name | (3R)-3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 126511033 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (3R)-3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid |
| SMILES | N[C@@H](COc1ccc(N(CCCl)CCCl)cc1)CC(=O)O |
| InChI | InChI=1S/C14H20Cl2N2O3/c15-5-7-18(8-6-16)12-1-3-13(4-2-12)21-10-11(17)9-14(19)20/h1-4,11H,5-10,17H2,(H,19,20)/t11-/m1/s1 |
| InChIKey | BBUCRRWBUXHNSB-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|