C16H26Cl2N2O3 — CID 145252014
3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid;ethane (PubChem CID 145252014) has the molecular formula C16H26Cl2N2O3 and a molecular weight of 365.30 g/mol. Its IUPAC name is 3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid;ethane.
| Compound Name | 3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid;ethane |
|---|---|
| PubChem CID | 145252014 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-amino-4-[4-[bis(2-chloroethyl)amino]phenoxy]butanoic acid;ethane |
| SMILES | CC.NC(COc1ccc(N(CCCl)CCCl)cc1)CC(=O)O |
| InChI | InChI=1S/C14H20Cl2N2O3.C2H6/c15-5-7-18(8-6-16)12-1-3-13(4-2-12)21-10-11(17)9-14(19)20;1-2/h1-4,11H,5-10,17H2,(H,19,20);1-2H3 |
| InChIKey | KFXNTXOREIDWPR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|