C19H28Cl2N2O5 — CID 126511028
(3R)-4-[4-[bis(2-chloroethyl)amino]phenoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 126511028) has the molecular formula C19H28Cl2N2O5 and a molecular weight of 435.35 g/mol. Its IUPAC name is (3R)-4-[4-[bis(2-chloroethyl)amino]phenoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3R)-4-[4-[bis(2-chloroethyl)amino]phenoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 126511028 |
| Molecular Formula | C19H28Cl2N2O5 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (3R)-4-[4-[bis(2-chloroethyl)amino]phenoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1ccc(N(CCCl)CCCl)cc1)CC(=O)O |
| InChI | InChI=1S/C19H28Cl2N2O5/c1-19(2,3)28-18(26)22-14(12-17(24)25)13-27-16-6-4-15(5-7-16)23(10-8-20)11-9-21/h4-7,14H,8-13H2,1-3H3,(H,22,26)(H,24,25)/t14-/m1/s1 |
| InChIKey | NLTJVWFECSFWOT-CQSZACIVSA-N |
| XLogP | 3.72 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|