C24H30Cl2N2O4 — CID 175096996
5-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 175096996) has the molecular formula C24H30Cl2N2O4 and a molecular weight of 481.42 g/mol. Its IUPAC name is 5-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 175096996 |
| Molecular Formula | C24H30Cl2N2O4 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 5-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1ccc(N(CCCl)CCCl)cc1CCC(CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30Cl2N2O4/c1-18-7-10-22(28(13-11-25)14-12-26)15-20(18)8-9-21(16-23(29)30)27-24(31)32-17-19-5-3-2-4-6-19/h2-7,10,15,21H,8-9,11-14,16-17H2,1H3,(H,27,31)(H,29,30) |
| InChIKey | NOSWXWUXNFDXTB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|