C14H18ClNO3 — CID 104701895
benzyl N-(6-chloro-5-oxohexan-3-yl)carbamate (PubChem CID 104701895) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is benzyl N-(6-chloro-5-oxohexan-3-yl)carbamate.
| Compound Name | benzyl N-(6-chloro-5-oxohexan-3-yl)carbamate |
|---|---|
| PubChem CID | 104701895 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | benzyl N-(6-chloro-5-oxohexan-3-yl)carbamate |
| SMILES | CCC(CC(=O)CCl)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H18ClNO3/c1-2-12(8-13(17)9-15)16-14(18)19-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,16,18) |
| InChIKey | GCCPCSQOHVQMMX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|