C21H22Cl3NO4 — CID 157156097
benzyl N-(4-chloro-3-oxo-1-phenylbutyl)carbamate;1,3-dichloropropan-2-one (PubChem CID 157156097) has the molecular formula C21H22Cl3NO4 and a molecular weight of 458.77 g/mol. Its IUPAC name is benzyl N-(4-chloro-3-oxo-1-phenylbutyl)carbamate;1,3-dichloropropan-2-one.
| Compound Name | benzyl N-(4-chloro-3-oxo-1-phenylbutyl)carbamate;1,3-dichloropropan-2-one |
|---|---|
| PubChem CID | 157156097 |
| Molecular Formula | C21H22Cl3NO4 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | benzyl N-(4-chloro-3-oxo-1-phenylbutyl)carbamate;1,3-dichloropropan-2-one |
| SMILES | O=C(CCl)CC(NC(=O)OCc1ccccc1)c1ccccc1.O=C(CCl)CCl |
| InChI | InChI=1S/C18H18ClNO3.C3H4Cl2O/c19-12-16(21)11-17(15-9-5-2-6-10-15)20-18(22)23-13-14-7-3-1-4-8-14;4-1-3(6)2-5/h1-10,17H,11-13H2,(H,20,22);1-2H2 |
| InChIKey | ALVAKHSGFRTZLZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|