C15H20N2O4 — CID 101334791
benzyl N-(1-acetamido-1-oxopentan-3-yl)carbamate (PubChem CID 101334791) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is benzyl N-(1-acetamido-1-oxopentan-3-yl)carbamate.
| Compound Name | benzyl N-(1-acetamido-1-oxopentan-3-yl)carbamate |
|---|---|
| PubChem CID | 101334791 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | benzyl N-(1-acetamido-1-oxopentan-3-yl)carbamate |
| SMILES | CCC(CC(=O)NC(C)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-13(9-14(19)16-11(2)18)17-15(20)21-10-12-7-5-4-6-8-12/h4-8,13H,3,9-10H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | HJPZFJKCXAJXHL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |