C17H28N2O8S2 — CID 118276939
4-amino-3-[5-[bis(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid (PubChem CID 118276939) has the molecular formula C17H28N2O8S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-amino-3-[5-[bis(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid.
| Compound Name | 4-amino-3-[5-[bis(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid |
|---|---|
| PubChem CID | 118276939 |
| Molecular Formula | C17H28N2O8S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-amino-3-[5-[bis(2-methylsulfonyloxyethyl)amino]-2-methylphenyl]butanoic acid |
| SMILES | Cc1ccc(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)cc1C(CN)CC(=O)O |
| InChI | InChI=1S/C17H28N2O8S2/c1-13-4-5-15(11-16(13)14(12-18)10-17(20)21)19(6-8-26-28(2,22)23)7-9-27-29(3,24)25/h4-5,11,14H,6-10,12,18H2,1-3H3,(H,20,21) |
| InChIKey | DLIZGGULIUEHLC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|