C17H23ClN2O9S — CID 10671916
(2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]phenoxy]carbonylamino]pentanedioic acid (PubChem CID 10671916) has the molecular formula C17H23ClN2O9S and a molecular weight of 466.90 g/mol. Its IUPAC name is (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]phenoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]phenoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 10671916 |
| Molecular Formula | C17H23ClN2O9S |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]phenoxy]carbonylamino]pentanedioic acid |
| SMILES | CS(=O)(=O)OCCN(CCCl)c1ccc(OC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H23ClN2O9S/c1-30(26,27)28-11-10-20(9-8-18)12-2-4-13(5-3-12)29-17(25)19-14(16(23)24)6-7-15(21)22/h2-5,14H,6-11H2,1H3,(H,19,25)(H,21,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | NGYGZQRIJCTTMJ-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|