C26H42N2O11S2 — CID 88510150
ditert-butyl (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioate (PubChem CID 88510150) has the molecular formula C26H42N2O11S2 and a molecular weight of 622.76 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 88510150 |
| Molecular Formula | C26H42N2O11S2 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H42N2O11S2/c1-25(2,3)38-22(29)14-13-21(24(31)39-26(4,5)6)27-23(30)19-9-11-20(12-10-19)28(15-17-36-40(7,32)33)16-18-37-41(8,34)35/h9-12,21H,13-18H2,1-8H3,(H,27,30)/t21-/m0/s1 |
| InChIKey | VZXSYQRZLSFIBC-NRFANRHFSA-N |
| XLogP | 2.01 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|