C22H34N2O5 — CID 67876922
ditert-butyl (2R)-2-[[4-(ethylamino)benzoyl]amino]pentanedioate (PubChem CID 67876922) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[[4-(ethylamino)benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2R)-2-[[4-(ethylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 67876922 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | ditert-butyl (2R)-2-[[4-(ethylamino)benzoyl]amino]pentanedioate |
| SMILES | CCNc1ccc(C(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H34N2O5/c1-8-23-16-11-9-15(10-12-16)19(26)24-17(20(27)29-22(5,6)7)13-14-18(25)28-21(2,3)4/h9-12,17,23H,8,13-14H2,1-7H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | IWCUOUFCSAKOPR-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |