C27H35N7O5 — CID 15616234
ditert-butyl (2S)-2-[[4-[(4-aminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 15616234) has the molecular formula C27H35N7O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-[(4-aminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-[(4-aminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 15616234 |
| Molecular Formula | C27H35N7O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-[(4-aminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3ncnc(N)c3n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35N7O5/c1-26(2,3)38-20(35)12-11-19(25(37)39-27(4,5)6)34-24(36)16-7-9-17(10-8-16)29-13-18-14-30-23-21(33-18)22(28)31-15-32-23/h7-10,14-15,19,29H,11-13H2,1-6H3,(H,34,36)(H2,28,30,31,32)/t19-/m0/s1 |
| InChIKey | ZCXRNBQOHMIWLC-IBGZPJMESA-N |
| XLogP | 3.18 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |