C33H31N7O6 — CID 174524463
dibenzyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 174524463) has the molecular formula C33H31N7O6 and a molecular weight of 621.65 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 174524463 |
| Molecular Formula | C33H31N7O6 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | dibenzyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)OCc4ccccc4)C(=O)OCc4ccccc4)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C33H31N7O6/c34-33-39-29-28(31(43)40-33)37-25(18-36-29)17-35-24-13-11-23(12-14-24)30(42)38-26(32(44)46-20-22-9-5-2-6-10-22)15-16-27(41)45-19-21-7-3-1-4-8-21/h1-14,18,26,35H,15-17,19-20H2,(H,38,42)(H3,34,36,39,40,43)/t26-/m0/s1 |
| InChIKey | PMPIWZKJKOHVSI-SANMLTNESA-N |
| XLogP | 3.27 |
| TPSA | 191.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |