C26H40N2O8S — CID 10602544
ditert-butyl (2S)-2-[[4-[3-(2,3-dihydroxypropylsulfanyl)propanoylamino]benzoyl]amino]pentanedioate (PubChem CID 10602544) has the molecular formula C26H40N2O8S and a molecular weight of 540.68 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-[3-(2,3-dihydroxypropylsulfanyl)propanoylamino]benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-[3-(2,3-dihydroxypropylsulfanyl)propanoylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10602544 |
| Molecular Formula | C26H40N2O8S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-[3-(2,3-dihydroxypropylsulfanyl)propanoylamino]benzoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(NC(=O)CCSCC(O)CO)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N2O8S/c1-25(2,3)35-22(32)12-11-20(24(34)36-26(4,5)6)28-23(33)17-7-9-18(10-8-17)27-21(31)13-14-37-16-19(30)15-29/h7-10,19-20,29-30H,11-16H2,1-6H3,(H,27,31)(H,28,33)/t19?,20-/m0/s1 |
| InChIKey | LJMHWGOHBUIVRB-ANYOKISRSA-N |
| XLogP | 2.66 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|