C25H32N2O5 — CID 174543173
ditert-butyl (2S)-2-[(6-phenylpyridine-3-carbonyl)amino]pentanedioate (PubChem CID 174543173) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(6-phenylpyridine-3-carbonyl)amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[(6-phenylpyridine-3-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 174543173 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ditert-butyl (2S)-2-[(6-phenylpyridine-3-carbonyl)amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(-c2ccccc2)nc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N2O5/c1-24(2,3)31-21(28)15-14-20(23(30)32-25(4,5)6)27-22(29)18-12-13-19(26-16-18)17-10-8-7-9-11-17/h7-13,16,20H,14-15H2,1-6H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | FFMKWPUDECGTPG-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |