C23H30N2O5S — CID 174543150
ditert-butyl (2S)-2-[[4-(1,3-thiazol-2-yl)benzoyl]amino]pentanedioate (PubChem CID 174543150) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-(1,3-thiazol-2-yl)benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-(1,3-thiazol-2-yl)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 174543150 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-(1,3-thiazol-2-yl)benzoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(-c2nccs2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H30N2O5S/c1-22(2,3)29-18(26)12-11-17(21(28)30-23(4,5)6)25-19(27)15-7-9-16(10-8-15)20-24-13-14-31-20/h7-10,13-14,17H,11-12H2,1-6H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | SAFZHDBEOAFZAV-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |