C33H45I2N3O6 — CID 67676261
ditert-butyl (2S)-2-[[(2S)-2-[[4-[4-[bis(2-iodoethyl)amino]phenyl]benzoyl]amino]propanoyl]amino]pentanedioate (PubChem CID 67676261) has the molecular formula C33H45I2N3O6 and a molecular weight of 833.55 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-2-[[4-[4-[bis(2-iodoethyl)amino]phenyl]benzoyl]amino]propanoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-2-[[4-[4-[bis(2-iodoethyl)amino]phenyl]benzoyl]amino]propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 67676261 |
| Molecular Formula | C33H45I2N3O6 |
| Molecular Weight | 833.55 g/mol |
| Exact Mass | 833.14 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-2-[[4-[4-[bis(2-iodoethyl)amino]phenyl]benzoyl]amino]propanoyl]amino]pentanedioate |
| SMILES | C[C@H](NC(=O)c1ccc(-c2ccc(N(CCI)CCI)cc2)cc1)C(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45I2N3O6/c1-22(29(40)37-27(31(42)44-33(5,6)7)16-17-28(39)43-32(2,3)4)36-30(41)25-10-8-23(9-11-25)24-12-14-26(15-13-24)38(20-18-34)21-19-35/h8-15,22,27H,16-21H2,1-7H3,(H,36,41)(H,37,40)/t22-,27-/m0/s1 |
| InChIKey | NSBYYZSQKPHELT-CUNXSJBXSA-N |
| XLogP | 6.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|