C24H32N2O5 — CID 54342071
tert-butyl (2S)-2-[[4-[4-[bis(2-hydroxyethyl)amino]phenyl]benzoyl]amino]propanoate (PubChem CID 54342071) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-[4-[bis(2-hydroxyethyl)amino]phenyl]benzoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[4-[4-[bis(2-hydroxyethyl)amino]phenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 54342071 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl (2S)-2-[[4-[4-[bis(2-hydroxyethyl)amino]phenyl]benzoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(-c2ccc(N(CCO)CCO)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N2O5/c1-17(23(30)31-24(2,3)4)25-22(29)20-7-5-18(6-8-20)19-9-11-21(12-10-19)26(13-15-27)14-16-28/h5-12,17,27-28H,13-16H2,1-4H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | TZRFRVCPHSNGCP-KRWDZBQOSA-N |
| XLogP | 2.60 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |