C20H28F3NO4 — CID 177395978
ditert-butyl (2S)-2-[4-(trifluoromethyl)anilino]pentanedioate (PubChem CID 177395978) has the molecular formula C20H28F3NO4 and a molecular weight of 403.44 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[4-(trifluoromethyl)anilino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[4-(trifluoromethyl)anilino]pentanedioate |
|---|---|
| PubChem CID | 177395978 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | ditert-butyl (2S)-2-[4-(trifluoromethyl)anilino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](Nc1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28F3NO4/c1-18(2,3)27-16(25)12-11-15(17(26)28-19(4,5)6)24-14-9-7-13(8-10-14)20(21,22)23/h7-10,15,24H,11-12H2,1-6H3/t15-/m0/s1 |
| InChIKey | BFEJTBOQSPQCKV-HNNXBMFYSA-N |
| XLogP | 4.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |