C18H26F3NO2 — CID 67369418
tert-butyl (2S)-4-methyl-2-[3-methyl-5-(trifluoromethyl)anilino]pentanoate (PubChem CID 67369418) has the molecular formula C18H26F3NO2 and a molecular weight of 345.41 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-[3-methyl-5-(trifluoromethyl)anilino]pentanoate.
| Compound Name | tert-butyl (2S)-4-methyl-2-[3-methyl-5-(trifluoromethyl)anilino]pentanoate |
|---|---|
| PubChem CID | 67369418 |
| Molecular Formula | C18H26F3NO2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-[3-methyl-5-(trifluoromethyl)anilino]pentanoate |
| SMILES | Cc1cc(N[C@@H](CC(C)C)C(=O)OC(C)(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F3NO2/c1-11(2)7-15(16(23)24-17(4,5)6)22-14-9-12(3)8-13(10-14)18(19,20)21/h8-11,15,22H,7H2,1-6H3/t15-/m0/s1 |
| InChIKey | VHXOBVRHENKMOM-HNNXBMFYSA-N |
| XLogP | 5.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |