C19H26F3N3O4 — CID 126563761
tert-butyl (2S)-2-[[2-[[4-(trifluoromethyl)phenyl]carbamoylamino]acetyl]amino]pentanoate (PubChem CID 126563761) has the molecular formula C19H26F3N3O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[[4-(trifluoromethyl)phenyl]carbamoylamino]acetyl]amino]pentanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[[4-(trifluoromethyl)phenyl]carbamoylamino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 126563761 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[[4-(trifluoromethyl)phenyl]carbamoylamino]acetyl]amino]pentanoate |
| SMILES | CCC[C@H](NC(=O)CNC(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26F3N3O4/c1-5-6-14(16(27)29-18(2,3)4)25-15(26)11-23-17(28)24-13-9-7-12(8-10-13)19(20,21)22/h7-10,14H,5-6,11H2,1-4H3,(H,25,26)(H2,23,24,28)/t14-/m0/s1 |
| InChIKey | NYTNWFJSJXFHNI-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |