C16H12ClF4N3O2 — CID 1055725
2-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 1055725) has the molecular formula C16H12ClF4N3O2 and a molecular weight of 389.74 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1055725 |
| Molecular Formula | C16H12ClF4N3O2 |
| Molecular Weight | 389.74 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNC(=O)Nc1ccc(F)c(Cl)c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12ClF4N3O2/c17-12-7-11(5-6-13(12)18)24-15(26)22-8-14(25)23-10-3-1-9(2-4-10)16(19,20)21/h1-7H,8H2,(H,23,25)(H2,22,24,26) |
| InChIKey | XXWFIHIDNVMSGS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |