C11H12F3N3O2 — CID 60848088
2-amino-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]acetamide (PubChem CID 60848088) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]acetamide |
|---|---|
| PubChem CID | 60848088 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)7-1-3-8(4-2-7)17-10(19)6-16-9(18)5-15/h1-4H,5-6,15H2,(H,16,18)(H,17,19) |
| InChIKey | RTXZEASNKYIOQP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |