C15H19F3N2O2 — CID 60565839
3,3-dimethyl-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]butanamide (PubChem CID 60565839) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]butanamide |
|---|---|
| PubChem CID | 60565839 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3,3-dimethyl-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-14(2,3)8-12(21)19-9-13(22)20-11-6-4-10(5-7-11)15(16,17)18/h4-7H,8-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | PZFZMMJNZAYYSV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |