C17H25N3O3 — CID 51091817
3,3-dimethyl-N-[2-oxo-2-[4-(propanoylamino)anilino]ethyl]butanamide (PubChem CID 51091817) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-oxo-2-[4-(propanoylamino)anilino]ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-oxo-2-[4-(propanoylamino)anilino]ethyl]butanamide |
|---|---|
| PubChem CID | 51091817 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3,3-dimethyl-N-[2-oxo-2-[4-(propanoylamino)anilino]ethyl]butanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)CNC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-5-14(21)19-12-6-8-13(9-7-12)20-16(23)11-18-15(22)10-17(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | BDZOVANDMMFRQA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |