C18H27N3O3 — CID 86829882
N-[2-[3-(butanoylamino)anilino]-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 86829882) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[2-[3-(butanoylamino)anilino]-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-[3-(butanoylamino)anilino]-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 86829882 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[2-[3-(butanoylamino)anilino]-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)CNC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-5-7-15(22)20-13-8-6-9-14(10-13)21-17(24)12-19-16(23)11-18(2,3)4/h6,8-10H,5,7,11-12H2,1-4H3,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | AJNYLIBVHUVEGG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |