C18H18Cl3N3O2 — CID 54816397
N-[3-[[2-(2,4,5-trichloroanilino)acetyl]amino]phenyl]butanamide (PubChem CID 54816397) has the molecular formula C18H18Cl3N3O2 and a molecular weight of 414.72 g/mol. Its IUPAC name is N-[3-[[2-(2,4,5-trichloroanilino)acetyl]amino]phenyl]butanamide.
| Compound Name | N-[3-[[2-(2,4,5-trichloroanilino)acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54816397 |
| Molecular Formula | C18H18Cl3N3O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[3-[[2-(2,4,5-trichloroanilino)acetyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)CNc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl3N3O2/c1-2-4-17(25)23-11-5-3-6-12(7-11)24-18(26)10-22-16-9-14(20)13(19)8-15(16)21/h3,5-9,22H,2,4,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AVTQLOYZCPJUPS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|