C21H26ClN3O2 — CID 54815058
N-[3-[[2-(3-chloro-2-methylanilino)acetyl]amino]phenyl]hexanamide (PubChem CID 54815058) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[3-[[2-(3-chloro-2-methylanilino)acetyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-(3-chloro-2-methylanilino)acetyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54815058 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[3-[[2-(3-chloro-2-methylanilino)acetyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-3-4-5-12-20(26)24-16-8-6-9-17(13-16)25-21(27)14-23-19-11-7-10-18(22)15(19)2/h6-11,13,23H,3-5,12,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | OSNQSHPGQRRDFL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|