C20H23Cl2N3O2 — CID 54813231
N-[3-[[2-(3,5-dichloroanilino)acetyl]amino]phenyl]hexanamide (PubChem CID 54813231) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[3-[[2-(3,5-dichloroanilino)acetyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-(3,5-dichloroanilino)acetyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54813231 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[3-[[2-(3,5-dichloroanilino)acetyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-2-3-4-8-19(26)24-16-6-5-7-17(12-16)25-20(27)13-23-18-10-14(21)9-15(22)11-18/h5-7,9-12,23H,2-4,8,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | AAQWHSDAJZBTGQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|