C16H14Cl3N3O2 — CID 54831443
2-(3-acetamidoanilino)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 54831443) has the molecular formula C16H14Cl3N3O2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(3-acetamidoanilino)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 54831443 |
| Molecular Formula | C16H14Cl3N3O2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-(3-acetamidoanilino)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC(=O)Nc1cccc(NCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl3N3O2/c1-9(23)21-11-4-2-3-10(5-11)20-8-16(24)22-15-7-13(18)12(17)6-14(15)19/h2-7,20H,8H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | QNORGAYYWNOPBD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|