C17H18FN3O2 — CID 54813242
N-[4-[[2-(4-fluoroanilino)acetyl]amino]phenyl]propanamide (PubChem CID 54813242) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[4-[[2-(4-fluoroanilino)acetyl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[2-(4-fluoroanilino)acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54813242 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[4-[[2-(4-fluoroanilino)acetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)CNc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18FN3O2/c1-2-16(22)20-14-7-9-15(10-8-14)21-17(23)11-19-13-5-3-12(18)4-6-13/h3-10,19H,2,11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HZOBXHGPCWKFFZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |