C17H17Cl2N3O2 — CID 54835369
N-[4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]phenyl]propanamide (PubChem CID 54835369) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54835369 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NCC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-2-16(23)21-14-5-3-13(4-6-14)20-10-17(24)22-15-8-11(18)7-12(19)9-15/h3-9,20H,2,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LOHXMIPEGPRVPT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |