C17H16Cl2N2O3 — CID 109011040
ethyl 4-[[2-(3,5-dichloroanilino)acetyl]amino]benzoate (PubChem CID 109011040) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is ethyl 4-[[2-(3,5-dichloroanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(3,5-dichloroanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 109011040 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | ethyl 4-[[2-(3,5-dichloroanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CNc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-2-24-17(23)11-3-5-14(6-4-11)21-16(22)10-20-15-8-12(18)7-13(19)9-15/h3-9,20H,2,10H2,1H3,(H,21,22) |
| InChIKey | QWPLYXAALDEANF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |