C16H13ClF3N3O2 — CID 1057516
2-[(3-chlorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 1057516) has the molecular formula C16H13ClF3N3O2 and a molecular weight of 371.75 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1057516 |
| Molecular Formula | C16H13ClF3N3O2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNC(=O)Nc1cccc(Cl)c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13ClF3N3O2/c17-11-2-1-3-13(8-11)23-15(25)21-9-14(24)22-12-6-4-10(5-7-12)16(18,19)20/h1-8H,9H2,(H,22,24)(H2,21,23,25) |
| InChIKey | GSMATVCFQMNDHZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |